C25H36O3 — CID 118101162
trans-(1R,3S,5Z)-5-[(E)-3-[3-(5-hydroxy-5-methylhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 118101162) has the molecular formula C25H36O3 and a molecular weight of 384.56 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-5-[(E)-3-[3-(5-hydroxy-5-methylhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-5-[(E)-3-[3-(5-hydroxy-5-methylhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 118101162 |
| Molecular Formula | C25H36O3 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | trans-(1R,3S,5Z)-5-[(E)-3-[3-(5-hydroxy-5-methylhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1/C(=C\C=C(/CC)c2cccc(CCCCC(C)(C)O)c2)C[C@@H](O)C[C@@H]1O |
| InChI | InChI=1S/C25H36O3/c1-5-20(12-13-21-16-23(26)17-24(27)18(21)2)22-11-8-10-19(15-22)9-6-7-14-25(3,4)28/h8,10-13,15,23-24,26-28H,2,5-7,9,14,16-17H2,1,3-4H3/b20-12+,21-13-/t23-,24+/m1/s1 |
| InChIKey | ZIUMXSAEMQMINR-NMTNPHOBSA-N |
| XLogP | 4.96 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|