C24H34O3 — CID 140746042
trans-(1R,3S,5Z)-5-[(E)-3-[3-(1,1,2,6,6,6-hexadeuterio-5-hydroxyhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol (PubChem CID 140746042) has the molecular formula C24H34O3 and a molecular weight of 376.57 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-5-[(E)-3-[3-(1,1,2,6,6,6-hexadeuterio-5-hydroxyhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-5-[(E)-3-[3-(1,1,2,6,6,6-hexadeuterio-5-hydroxyhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 140746042 |
| Molecular Formula | C24H34O3 |
| Molecular Weight | 376.57 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | trans-(1R,3S,5Z)-5-[(E)-3-[3-(1,1,2,6,6,6-hexadeuterio-5-hydroxyhexyl)phenyl]pent-2-enylidene]-4-methylidenecyclohexane-1,3-diol |
| SMILES | [2H]C(CCC(O)C([2H])([2H])[2H])C([2H])([2H])c1cccc(/C(=C/C=C2/C[C@@H](O)C[C@H](O)C2=C)CC)c1 |
| InChI | InChI=1S/C24H34O3/c1-4-20(12-13-21-15-23(26)16-24(27)18(21)3)22-11-7-10-19(14-22)9-6-5-8-17(2)25/h7,10-14,17,23-27H,3-6,8-9,15-16H2,1-2H3/b20-12+,21-13-/t17?,23-,24+/m1/s1/i2D3,6D,9D2/t6?,17?,23-,24+ |
| InChIKey | DLBHBNFUGFQANB-QERBBFSKSA-N |
| XLogP | 4.57 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.57 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |