C31H49O2P — CID 123946180
3-[3-[3-(6-hydroxy-6-methylheptyl)phenyl]dec-2-enylidene]-2-methylidene-5-phosphanylcyclohexan-1-ol (PubChem CID 123946180) has the molecular formula C31H49O2P and a molecular weight of 484.71 g/mol. Its IUPAC name is 3-[3-[3-(6-hydroxy-6-methylheptyl)phenyl]dec-2-enylidene]-2-methylidene-5-phosphanylcyclohexan-1-ol.
| Compound Name | 3-[3-[3-(6-hydroxy-6-methylheptyl)phenyl]dec-2-enylidene]-2-methylidene-5-phosphanylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123946180 |
| Molecular Formula | C31H49O2P |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.35 |
| IUPAC Name | 3-[3-[3-(6-hydroxy-6-methylheptyl)phenyl]dec-2-enylidene]-2-methylidene-5-phosphanylcyclohexan-1-ol |
| SMILES | C=C1C(=CC=C(CCCCCCC)c2cccc(CCCCCC(C)(C)O)c2)CC(P)CC1O |
| InChI | InChI=1S/C31H49O2P/c1-5-6-7-8-11-16-26(18-19-27-22-29(34)23-30(32)24(27)2)28-17-13-15-25(21-28)14-10-9-12-20-31(3,4)33/h13,15,17-19,21,29-30,32-33H,2,5-12,14,16,20,22-23,34H2,1,3-4H3 |
| InChIKey | VIBWHLVHYFEKTA-UHFFFAOYSA-N |
| XLogP | 8.19 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 8.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|