C21H36Si — CID 158607350
[(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane (PubChem CID 158607350) has the molecular formula C21H36Si and a molecular weight of 316.61 g/mol. Its IUPAC name is [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane.
| Compound Name | [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 158607350 |
| Molecular Formula | C21H36Si |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane |
| SMILES | CC/C(=C\[Si](C)(C)C)c1cccc(CCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C21H36Si/c1-8-19(17-22(5,6)7)20-14-11-13-18(16-20)12-9-10-15-21(2,3)4/h11,13-14,16-17H,8-10,12,15H2,1-7H3/b19-17+ |
| InChIKey | DITVCHQQTJPCTH-HTXNQAPBSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|