About [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane
[(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane (PubChem CID 158607350) has the molecular formula C21H36Si
and a molecular weight of 316.61 g/mol. Its IUPAC name is [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane.
Molecular Properties
| Compound Name | [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane |
| PubChem CID | 158607350 |
| Molecular Formula | C21H36Si |
| Molecular Weight | 316.61 g/mol |
| Exact Mass | 316.26 |
| IUPAC Name | [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane |
| SMILES | CC/C(=C\[Si](C)(C)C)c1cccc(CCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C21H36Si/c1-8-19(17-22(5,6)7)20-14-11-13-18(16-20)12-9-10-15-21(2,3)4/h11,13-14,16-17H,8-10,12,15H2,1-7H3/b19-17+ |
| InChIKey | DITVCHQQTJPCTH-HTXNQAPBSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.61 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane?
The IUPAC name of [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane (CID 158607350) is [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane.
What is the SMILES notation for [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane?
The canonical SMILES for [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane is CC/C(=C\[Si](C)(C)C)c1cccc(CCCCC(C)(C)C)c1.
What is the InChIKey of [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane?
The InChIKey is DITVCHQQTJPCTH-HTXNQAPBSA-N. The full InChI is InChI=1S/C21H36Si/c1-8-19(17-22(5,6)7)20-14-11-13-18(16-20)12-9-10-15-21(2,3)4/h11,13-14,16-17H,8-10,12,15H2,1-7H3/b19-17+.
What are the key properties of [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane?
[(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane has a molecular weight of 316.61 g/mol, XLogP of 7.12, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-2-[3-(5,5-dimethylhexyl)phenyl]but-1-enyl]-trimethylsilane is sourced from PubChem (CID 158607350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).