C41H67ISi — CID 160995452
1-(6,6-dimethylheptyl)-3-[(E)-1-iodobut-1-en-2-yl]benzene;[(E)-2-[3-(6,6-dimethylheptyl)phenyl]but-1-enyl]-trimethylsilane (PubChem CID 160995452) has the molecular formula C41H67ISi and a molecular weight of 714.98 g/mol. Its IUPAC name is 1-(6,6-dimethylheptyl)-3-[(E)-1-iodobut-1-en-2-yl]benzene;[(E)-2-[3-(6,6-dimethylheptyl)phenyl]but-1-enyl]-trimethylsilane.
| Compound Name | 1-(6,6-dimethylheptyl)-3-[(E)-1-iodobut-1-en-2-yl]benzene;[(E)-2-[3-(6,6-dimethylheptyl)phenyl]but-1-enyl]-trimethylsilane |
|---|---|
| PubChem CID | 160995452 |
| Molecular Formula | C41H67ISi |
| Molecular Weight | 714.98 g/mol |
| Exact Mass | 714.41 |
| IUPAC Name | 1-(6,6-dimethylheptyl)-3-[(E)-1-iodobut-1-en-2-yl]benzene;[(E)-2-[3-(6,6-dimethylheptyl)phenyl]but-1-enyl]-trimethylsilane |
| SMILES | CC/C(=C\I)c1cccc(CCCCCC(C)(C)C)c1.CC/C(=C\[Si](C)(C)C)c1cccc(CCCCCC(C)(C)C)c1 |
| InChI | InChI=1S/C22H38Si.C19H29I/c1-8-20(18-23(5,6)7)21-15-12-14-19(17-21)13-10-9-11-16-22(2,3)4;1-5-17(15-20)18-12-9-11-16(14-18)10-7-6-8-13-19(2,3)4/h12,14-15,17-18H,8-11,13,16H2,1-7H3;9,11-12,14-15H,5-8,10,13H2,1-4H3/b20-18+;17-15+ |
| InChIKey | TVELIZIGVSDDDN-OQCIVZKTSA-N |
| XLogP | 14.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.98 |
| LogP ≤ 5 | 14.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|