C26H38O3 — CID 122552431
trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[3-[7,7,7-trideuterio-6-hydroxy-6-(trideuteriomethyl)heptyl]phenyl]pent-2-enylidene]cyclohexane-1,3-diol (PubChem CID 122552431) has the molecular formula C26H38O3 and a molecular weight of 404.62 g/mol. Its IUPAC name is trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[3-[7,7,7-trideuterio-6-hydroxy-6-(trideuteriomethyl)heptyl]phenyl]pent-2-enylidene]cyclohexane-1,3-diol.
| Compound Name | trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[3-[7,7,7-trideuterio-6-hydroxy-6-(trideuteriomethyl)heptyl]phenyl]pent-2-enylidene]cyclohexane-1,3-diol |
|---|---|
| PubChem CID | 122552431 |
| Molecular Formula | C26H38O3 |
| Molecular Weight | 404.62 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | trans-(1R,3S,5Z)-4-methylidene-5-[(E)-3-[3-[7,7,7-trideuterio-6-hydroxy-6-(trideuteriomethyl)heptyl]phenyl]pent-2-enylidene]cyclohexane-1,3-diol |
| SMILES | [2H]C([2H])([2H])C(O)(CCCCCc1cccc(/C(=C/C=C2/C[C@@H](O)C[C@H](O)C2=C)CC)c1)C([2H])([2H])[2H] |
| InChI | InChI=1S/C26H38O3/c1-5-21(13-14-22-17-24(27)18-25(28)19(22)2)23-12-9-11-20(16-23)10-7-6-8-15-26(3,4)29/h9,11-14,16,24-25,27-29H,2,5-8,10,15,17-18H2,1,3-4H3/b21-13+,22-14-/t24-,25+/m1/s1/i3D3,4D3 |
| InChIKey | BQVXPWDQMUNMLU-SJONVWCISA-N |
| XLogP | 5.35 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|