C27H36O3 — CID 54086470
7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-3-ethylnona-4,6-dien-3-ol (PubChem CID 54086470) has the molecular formula C27H36O3 and a molecular weight of 408.58 g/mol. Its IUPAC name is 7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-3-ethylnona-4,6-dien-3-ol.
| Compound Name | 7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-3-ethylnona-4,6-dien-3-ol |
|---|---|
| PubChem CID | 54086470 |
| Molecular Formula | C27H36O3 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.27 |
| IUPAC Name | 7-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]phenyl]-3-ethylnona-4,6-dien-3-ol |
| SMILES | CCC(=CC=CC(O)(CC)CC)c1cccc(CCc2ccc(CO)c(CO)c2)c1 |
| InChI | InChI=1S/C27H36O3/c1-4-23(11-8-16-27(30,5-2)6-3)24-10-7-9-21(17-24)12-13-22-14-15-25(19-28)26(18-22)20-29/h7-11,14-18,28-30H,4-6,12-13,19-20H2,1-3H3 |
| InChIKey | MQVQVTPMLKHAJK-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|