C24H42O2Si — CID 57303801
[3-(7-ethyl-7-triethylsilyloxynon-3-en-3-yl)phenyl]methanol (PubChem CID 57303801) has the molecular formula C24H42O2Si and a molecular weight of 390.68 g/mol. Its IUPAC name is [3-(7-ethyl-7-triethylsilyloxynon-3-en-3-yl)phenyl]methanol.
| Compound Name | [3-(7-ethyl-7-triethylsilyloxynon-3-en-3-yl)phenyl]methanol |
|---|---|
| PubChem CID | 57303801 |
| Molecular Formula | C24H42O2Si |
| Molecular Weight | 390.68 g/mol |
| Exact Mass | 390.30 |
| IUPAC Name | [3-(7-ethyl-7-triethylsilyloxynon-3-en-3-yl)phenyl]methanol |
| SMILES | CCC(=CCCC(CC)(CC)O[Si](CC)(CC)CC)c1cccc(CO)c1 |
| InChI | InChI=1S/C24H42O2Si/c1-7-22(23-16-13-15-21(19-23)20-25)17-14-18-24(8-2,9-3)26-27(10-4,11-5)12-6/h13,15-17,19,25H,7-12,14,18,20H2,1-6H3 |
| InChIKey | HFLILUQLDFAXLR-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|