C23H39BrOSi — CID 23439910
[(Z)-7-(3-bromophenyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane (PubChem CID 23439910) has the molecular formula C23H39BrOSi and a molecular weight of 439.55 g/mol. Its IUPAC name is [(Z)-7-(3-bromophenyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane.
| Compound Name | [(Z)-7-(3-bromophenyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 23439910 |
| Molecular Formula | C23H39BrOSi |
| Molecular Weight | 439.55 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | [(Z)-7-(3-bromophenyl)-3-ethylnon-6-en-3-yl]oxy-triethylsilane |
| SMILES | CC/C(=C/CCC(CC)(CC)O[Si](CC)(CC)CC)c1cccc(Br)c1 |
| InChI | InChI=1S/C23H39BrOSi/c1-7-20(21-15-13-17-22(24)19-21)16-14-18-23(8-2,9-3)25-26(10-4,11-5)12-6/h13,15-17,19H,7-12,14,18H2,1-6H3/b20-16- |
| InChIKey | NDPKPRDQJHZWMM-SILNSSARSA-N |
| XLogP | 8.60 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.55 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|