C18H12Br2Cl2N2 — CID 43835164
(E,Z)-3-(3-bromophenyl)-N-[(E)-[(Z)-3-(3-bromophenyl)-3-chloroprop-2-enylidene]amino]-3-chloroprop-2-en-1-imine (PubChem CID 43835164) has the molecular formula C18H12Br2Cl2N2 and a molecular weight of 487.02 g/mol. Its IUPAC name is (E,Z)-3-(3-bromophenyl)-N-[(E)-[(Z)-3-(3-bromophenyl)-3-chloroprop-2-enylidene]amino]-3-chloroprop-2-en-1-imine.
| Compound Name | (E,Z)-3-(3-bromophenyl)-N-[(E)-[(Z)-3-(3-bromophenyl)-3-chloroprop-2-enylidene]amino]-3-chloroprop-2-en-1-imine |
|---|---|
| PubChem CID | 43835164 |
| Molecular Formula | C18H12Br2Cl2N2 |
| Molecular Weight | 487.02 g/mol |
| Exact Mass | 483.87 |
| IUPAC Name | (E,Z)-3-(3-bromophenyl)-N-[(E)-[(Z)-3-(3-bromophenyl)-3-chloroprop-2-enylidene]amino]-3-chloroprop-2-en-1-imine |
| SMILES | Cl/C(=C\C=N\N=C\C=C(/Cl)c1cccc(Br)c1)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H12Br2Cl2N2/c19-15-5-1-3-13(11-15)17(21)7-9-23-24-10-8-18(22)14-4-2-6-16(20)12-14/h1-12H/b17-7-,18-8-,23-9+,24-10+ |
| InChIKey | QXVHJVKGMLECJR-FBGFMTOBSA-N |
| XLogP | 7.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.02 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|