C37H52F6O3Si2 — CID 87504064
(E)-6-[3-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol (PubChem CID 87504064) has the molecular formula C37H52F6O3Si2 and a molecular weight of 714.98 g/mol. Its IUPAC name is (E)-6-[3-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol.
| Compound Name | (E)-6-[3-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol |
|---|---|
| PubChem CID | 87504064 |
| Molecular Formula | C37H52F6O3Si2 |
| Molecular Weight | 714.98 g/mol |
| Exact Mass | 714.34 |
| IUPAC Name | (E)-6-[3-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]phenyl]-1,1,1-trifluoro-2-(trifluoromethyl)oct-5-en-3-yn-2-ol |
| SMILES | CC/C(=C\C#CC(O)(C(F)(F)F)C(F)(F)F)c1cccc(CCc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C37H52F6O3Si2/c1-12-29(17-14-22-35(44,36(38,39)40)37(41,42)43)30-16-13-15-27(23-30)18-19-28-20-21-31(25-45-47(8,9)33(2,3)4)32(24-28)26-46-48(10,11)34(5,6)7/h13,15-17,20-21,23-24,44H,12,18-19,25-26H2,1-11H3/b29-17+ |
| InChIKey | LQSOGYJRCHOYGC-STBIYBPSSA-N |
| XLogP | 11.17 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.98 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|