C34H56O4SSi2 — CID 91330596
methyl 5-[5-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoate (PubChem CID 91330596) has the molecular formula C34H56O4SSi2 and a molecular weight of 617.06 g/mol. Its IUPAC name is methyl 5-[5-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoate.
| Compound Name | methyl 5-[5-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoate |
|---|---|
| PubChem CID | 91330596 |
| Molecular Formula | C34H56O4SSi2 |
| Molecular Weight | 617.06 g/mol |
| Exact Mass | 616.34 |
| IUPAC Name | methyl 5-[5-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]hept-4-enoate |
| SMILES | CCC(=CCCC(=O)OC)c1ccc(CCc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C34H56O4SSi2/c1-13-27(15-14-16-32(35)36-8)31-22-21-30(39-31)20-18-26-17-19-28(24-37-40(9,10)33(2,3)4)29(23-26)25-38-41(11,12)34(5,6)7/h15,17,19,21-23H,13-14,16,18,20,24-25H2,1-12H3 |
| InChIKey | VIXYNVQAUFHXFT-UHFFFAOYSA-N |
| XLogP | 10.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.06 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|