C33H54O5SSi2 — CID 131724375
methyl (E)-5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hept-4-enoate (PubChem CID 131724375) has the molecular formula C33H54O5SSi2 and a molecular weight of 619.03 g/mol. Its IUPAC name is methyl (E)-5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hept-4-enoate.
| Compound Name | methyl (E)-5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hept-4-enoate |
|---|---|
| PubChem CID | 131724375 |
| Molecular Formula | C33H54O5SSi2 |
| Molecular Weight | 619.03 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | methyl (E)-5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hept-4-enoate |
| SMILES | CC/C(=C\CCC(=O)OC)c1ccc(COc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C33H54O5SSi2/c1-13-25(15-14-16-31(34)35-8)30-20-19-29(39-30)24-36-28-18-17-26(22-37-40(9,10)32(2,3)4)27(21-28)23-38-41(11,12)33(5,6)7/h15,17-21H,13-14,16,22-24H2,1-12H3/b25-15+ |
| InChIKey | OIXVHXWWMYFHLL-MFKUBSTISA-N |
| XLogP | 10.12 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.03 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|