C30H44O4SSi2 — CID 173217319
CID 173217319 (PubChem CID 173217319) has the molecular formula C30H44O4SSi2 and a molecular weight of 556.92 g/mol.
| Compound Name | CID 173217319 |
|---|---|
| PubChem CID | 173217319 |
| Molecular Formula | C30H44O4SSi2 |
| Molecular Weight | 556.92 g/mol |
| Exact Mass | 556.25 |
| IUPAC Name | — |
| SMILES | CCC(=CC=O)c1ccc(COc2ccc(C(C)(C)O[Si]C(C)(C)C)c(C(C)(C)O[Si]C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C30H44O4SSi2/c1-12-21(17-18-31)26-16-14-23(35-26)20-32-22-13-15-24(29(8,9)33-36-27(2,3)4)25(19-22)30(10,11)34-37-28(5,6)7/h13-19H,12,20H2,1-11H3 |
| InChIKey | WWADKGKKSLSMJV-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.92 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|