C34H54O5SSi2 — CID 90886977
ethyl 5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hepta-2,4-dienoate (PubChem CID 90886977) has the molecular formula C34H54O5SSi2 and a molecular weight of 631.04 g/mol. Its IUPAC name is ethyl 5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hepta-2,4-dienoate.
| Compound Name | ethyl 5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hepta-2,4-dienoate |
|---|---|
| PubChem CID | 90886977 |
| Molecular Formula | C34H54O5SSi2 |
| Molecular Weight | 631.04 g/mol |
| Exact Mass | 630.32 |
| IUPAC Name | ethyl 5-[5-[[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenoxy]methyl]thiophen-2-yl]hepta-2,4-dienoate |
| SMILES | CCOC(=O)C=CC=C(CC)c1ccc(COc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)s1 |
| InChI | InChI=1S/C34H54O5SSi2/c1-13-26(16-15-17-32(35)36-14-2)31-21-20-30(40-31)25-37-29-19-18-27(23-38-41(9,10)33(3,4)5)28(22-29)24-39-42(11,12)34(6,7)8/h15-22H,13-14,23-25H2,1-12H3 |
| InChIKey | OZWQSNCTAJWFSM-UHFFFAOYSA-N |
| XLogP | 10.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.04 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|