C33H54O4SSi2 — CID 90856773
ethyl 3-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]pent-2-enoate (PubChem CID 90856773) has the molecular formula C33H54O4SSi2 and a molecular weight of 603.03 g/mol. Its IUPAC name is ethyl 3-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]pent-2-enoate.
| Compound Name | ethyl 3-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]pent-2-enoate |
|---|---|
| PubChem CID | 90856773 |
| Molecular Formula | C33H54O4SSi2 |
| Molecular Weight | 603.03 g/mol |
| Exact Mass | 602.33 |
| IUPAC Name | ethyl 3-[4-[2-[3,4-bis[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]ethyl]thiophen-2-yl]pent-2-enoate |
| SMILES | CCOC(=O)C=C(CC)c1cc(CCc2ccc(CO[Si](C)(C)C(C)(C)C)c(CO[Si](C)(C)C(C)(C)C)c2)cs1 |
| InChI | InChI=1S/C33H54O4SSi2/c1-13-27(21-31(34)35-14-2)30-20-26(24-38-30)16-15-25-17-18-28(22-36-39(9,10)32(3,4)5)29(19-25)23-37-40(11,12)33(6,7)8/h17-21,24H,13-16,22-23H2,1-12H3 |
| InChIKey | KQGHPOUTCLWIGF-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.03 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|