C24H40O4Si — CID 54227728
ethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenyl]oct-2-enoate (PubChem CID 54227728) has the molecular formula C24H40O4Si and a molecular weight of 420.67 g/mol. Its IUPAC name is ethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenyl]oct-2-enoate.
| Compound Name | ethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenyl]oct-2-enoate |
|---|---|
| PubChem CID | 54227728 |
| Molecular Formula | C24H40O4Si |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 420.27 |
| IUPAC Name | ethyl 3-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-methoxyphenyl]oct-2-enoate |
| SMILES | CCCCCC(=CC(=O)OCC)c1ccc(CO[Si](C)(C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C24H40O4Si/c1-9-11-12-13-20(17-23(25)27-10-2)21-15-14-19(16-22(21)26-6)18-28-29(7,8)24(3,4)5/h14-17H,9-13,18H2,1-8H3 |
| InChIKey | QHAWHEGMBZXOCX-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|