C24H32O4S — CID 86759394
(4E,6E)-7-[5-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-3-yl]-3-ethylnona-4,6-dien-3-ol (PubChem CID 86759394) has the molecular formula C24H32O4S and a molecular weight of 416.58 g/mol. Its IUPAC name is (4E,6E)-7-[5-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-3-yl]-3-ethylnona-4,6-dien-3-ol.
| Compound Name | (4E,6E)-7-[5-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-3-yl]-3-ethylnona-4,6-dien-3-ol |
|---|---|
| PubChem CID | 86759394 |
| Molecular Formula | C24H32O4S |
| Molecular Weight | 416.58 g/mol |
| Exact Mass | 416.20 |
| IUPAC Name | (4E,6E)-7-[5-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-3-yl]-3-ethylnona-4,6-dien-3-ol |
| SMILES | CC/C(=C\C=C\C(O)(CC)CC)c1csc(COc2ccc(CO)c(CO)c2)c1 |
| InChI | InChI=1S/C24H32O4S/c1-4-18(8-7-11-24(27,5-2)6-3)21-13-23(29-17-21)16-28-22-10-9-19(14-25)20(12-22)15-26/h7-13,17,25-27H,4-6,14-16H2,1-3H3/b11-7+,18-8+ |
| InChIKey | OUPLEBHDHHTEQC-BTSJBCBBSA-N |
| XLogP | 5.21 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|