C24H24F6O5S — CID 159652587
2-[2-[4-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-2-yl]-6-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methanol (PubChem CID 159652587) has the molecular formula C24H24F6O5S and a molecular weight of 538.51 g/mol. Its IUPAC name is 2-[2-[4-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-2-yl]-6-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methanol.
| Compound Name | 2-[2-[4-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-2-yl]-6-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methanol |
|---|---|
| PubChem CID | 159652587 |
| Molecular Formula | C24H24F6O5S |
| Molecular Weight | 538.51 g/mol |
| Exact Mass | 538.12 |
| IUPAC Name | 2-[2-[4-[[3,4-bis(hydroxymethyl)phenoxy]methyl]thiophen-2-yl]-6-methylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol;methanol |
| SMILES | CO.Cc1cccc(-c2cc(COc3ccc(CO)c(CO)c3)cs2)c1C(O)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C23H20F6O4S.CH4O/c1-13-3-2-4-18(20(13)21(32,22(24,25)26)23(27,28)29)19-7-14(12-34-19)11-33-17-6-5-15(9-30)16(8-17)10-31;1-2/h2-8,12,30-32H,9-11H2,1H3;2H,1H3 |
| InChIKey | MRTMDSBVRYSLIM-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |