C27H31F3N2O3 — CID 143974514
2-amino-2-[[2-[2-methyl-5-[[4-[2-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethylamino]methyl]propane-1,3-diol (PubChem CID 143974514) has the molecular formula C27H31F3N2O3 and a molecular weight of 488.55 g/mol. Its IUPAC name is 2-amino-2-[[2-[2-methyl-5-[[4-[2-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethylamino]methyl]propane-1,3-diol.
| Compound Name | 2-amino-2-[[2-[2-methyl-5-[[4-[2-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethylamino]methyl]propane-1,3-diol |
|---|---|
| PubChem CID | 143974514 |
| Molecular Formula | C27H31F3N2O3 |
| Molecular Weight | 488.55 g/mol |
| Exact Mass | 488.23 |
| IUPAC Name | 2-amino-2-[[2-[2-methyl-5-[[4-[2-(trifluoromethyl)phenyl]phenyl]methoxy]phenyl]ethylamino]methyl]propane-1,3-diol |
| SMILES | Cc1ccc(OCc2ccc(-c3ccccc3C(F)(F)F)cc2)cc1CCNCC(N)(CO)CO |
| InChI | InChI=1S/C27H31F3N2O3/c1-19-6-11-23(14-22(19)12-13-32-16-26(31,17-33)18-34)35-15-20-7-9-21(10-8-20)24-4-2-3-5-25(24)27(28,29)30/h2-11,14,32-34H,12-13,15-18,31H2,1H3 |
| InChIKey | DUFYUIDFKRSVLM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.55 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|