C19H12F6OS — CID 141057638
4-[[4-(trifluoromethyl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]thiophene (PubChem CID 141057638) has the molecular formula C19H12F6OS and a molecular weight of 402.36 g/mol. Its IUPAC name is 4-[[4-(trifluoromethyl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]thiophene.
| Compound Name | 4-[[4-(trifluoromethyl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]thiophene |
|---|---|
| PubChem CID | 141057638 |
| Molecular Formula | C19H12F6OS |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 4-[[4-(trifluoromethyl)phenoxy]methyl]-2-[4-(trifluoromethyl)phenyl]thiophene |
| SMILES | FC(F)(F)c1ccc(OCc2csc(-c3ccc(C(F)(F)F)cc3)c2)cc1 |
| InChI | InChI=1S/C19H12F6OS/c20-18(21,22)14-3-1-13(2-4-14)17-9-12(11-27-17)10-26-16-7-5-15(6-8-16)19(23,24)25/h1-9,11H,10H2 |
| InChIKey | BOFKBMGJRIQQHT-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |