C29H30F6O4 — CID 11977557
2-[4-[5-[[3,4-bis(hydroxymethyl)phenyl]methoxy]-2-ethylphenyl]-3-propylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 11977557) has the molecular formula C29H30F6O4 and a molecular weight of 556.54 g/mol. Its IUPAC name is 2-[4-[5-[[3,4-bis(hydroxymethyl)phenyl]methoxy]-2-ethylphenyl]-3-propylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[5-[[3,4-bis(hydroxymethyl)phenyl]methoxy]-2-ethylphenyl]-3-propylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 11977557 |
| Molecular Formula | C29H30F6O4 |
| Molecular Weight | 556.54 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | 2-[4-[5-[[3,4-bis(hydroxymethyl)phenyl]methoxy]-2-ethylphenyl]-3-propylphenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1-c1cc(OCc2ccc(CO)c(CO)c2)ccc1CC |
| InChI | InChI=1S/C29H30F6O4/c1-3-5-20-13-23(27(38,28(30,31)32)29(33,34)35)9-11-25(20)26-14-24(10-8-19(26)4-2)39-17-18-6-7-21(15-36)22(12-18)16-37/h6-14,36-38H,3-5,15-17H2,1-2H3 |
| InChIKey | HYZHJBVQYLTOJC-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.54 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |