C29H30F6O3 — CID 22345648
2-[4-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-6-methyl-2-propylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 22345648) has the molecular formula C29H30F6O3 and a molecular weight of 540.54 g/mol. Its IUPAC name is 2-[4-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-6-methyl-2-propylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-6-methyl-2-propylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 22345648 |
| Molecular Formula | C29H30F6O3 |
| Molecular Weight | 540.54 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 2-[4-[3-[2-[3,4-bis(hydroxymethyl)phenyl]ethyl]-6-methyl-2-propylphenyl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CCCc1c(CCc2ccc(CO)c(CO)c2)ccc(C)c1-c1ccc(C(O)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C29H30F6O3/c1-3-4-25-20(9-6-19-7-10-22(16-36)23(15-19)17-37)8-5-18(2)26(25)21-11-13-24(14-12-21)27(38,28(30,31)32)29(33,34)35/h5,7-8,10-15,36-38H,3-4,6,9,16-17H2,1-2H3 |
| InChIKey | APEFYGLWXDBJHO-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.54 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |