C35H38F6N2O7 — CID 59234945
5-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59234945) has the molecular formula C35H38F6N2O7 and a molecular weight of 712.68 g/mol. Its IUPAC name is 5-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59234945 |
| Molecular Formula | C35H38F6N2O7 |
| Molecular Weight | 712.68 g/mol |
| Exact Mass | 712.26 |
| IUPAC Name | 5-[4-[(3,5-dimethoxyphenyl)methoxy]phenyl]-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc(OCc3cc(OC)cc(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C35H38F6N2O7/c1-5-8-23-19-25(33(46,34(36,37)38)35(39,40)41)11-14-29(23)49-16-7-6-15-43-30(44)32(2,42-31(43)45)24-9-12-26(13-10-24)50-21-22-17-27(47-3)20-28(18-22)48-4/h9-14,17-20,46H,5-8,15-16,21H2,1-4H3,(H,42,45) |
| InChIKey | JPKRDYNPKGEVOL-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 106.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|