C37H42F6N2O7 — CID 89151984
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-[4-[(3-hydroxy-5-methoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione (PubChem CID 89151984) has the molecular formula C37H42F6N2O7 and a molecular weight of 740.74 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-[4-[(3-hydroxy-5-methoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-[4-[(3-hydroxy-5-methoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89151984 |
| Molecular Formula | C37H42F6N2O7 |
| Molecular Weight | 740.74 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-[4-[(3-hydroxy-5-methoxyphenyl)methoxy]phenyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCN1C(=O)NC(C)(c2ccc(OCc3cc(O)cc(OC)c3)cc2)C1=O |
| InChI | InChI=1S/C37H42F6N2O7/c1-5-9-24-19-27(35(49,36(38,39)40)37(41,42)43)20-25(10-6-2)31(24)51-16-8-7-15-45-32(47)34(3,44-33(45)48)26-11-13-29(14-12-26)52-22-23-17-28(46)21-30(18-23)50-4/h11-14,17-21,46,49H,5-10,15-16,22H2,1-4H3,(H,44,48) |
| InChIKey | VYNOANYOHYDLHG-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.74 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|