C27H30F6N2O6 — CID 89151999
5-(3,4-dihydroxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 89151999) has the molecular formula C27H30F6N2O6 and a molecular weight of 592.53 g/mol. Its IUPAC name is 5-(3,4-dihydroxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dihydroxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89151999 |
| Molecular Formula | C27H30F6N2O6 |
| Molecular Weight | 592.53 g/mol |
| Exact Mass | 592.20 |
| IUPAC Name | 5-(3,4-dihydroxyphenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C)c1OCCCCN1C(=O)NC(C)(c2ccc(O)c(O)c2)C1=O |
| InChI | InChI=1S/C27H30F6N2O6/c1-4-7-16-13-18(25(40,26(28,29)30)27(31,32)33)12-15(2)21(16)41-11-6-5-10-35-22(38)24(3,34-23(35)39)17-8-9-19(36)20(37)14-17/h8-9,12-14,36-37,40H,4-7,10-11H2,1-3H3,(H,34,39) |
| InChIKey | YTPCBLDJURLBQB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 119.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.53 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|