C26H36F6N2O4 — CID 59235008
3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]pentyl]-1,5,5-trimethylimidazolidine-2,4-dione (PubChem CID 59235008) has the molecular formula C26H36F6N2O4 and a molecular weight of 554.57 g/mol. Its IUPAC name is 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]pentyl]-1,5,5-trimethylimidazolidine-2,4-dione.
| Compound Name | 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]pentyl]-1,5,5-trimethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235008 |
| Molecular Formula | C26H36F6N2O4 |
| Molecular Weight | 554.57 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]pentyl]-1,5,5-trimethylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCCN1C(=O)N(C)C(C)(C)C1=O |
| InChI | InChI=1S/C26H36F6N2O4/c1-6-11-17-15-19(24(37,25(27,28)29)26(30,31)32)16-18(12-7-2)20(17)38-14-10-8-9-13-34-21(35)23(3,4)33(5)22(34)36/h15-16,37H,6-14H2,1-5H3 |
| InChIKey | JWRYWZGOXSDUEB-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.57 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|