C35H43F6NO5 — CID 89151992
3-ethyl-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-3-(4-propan-2-yloxyphenyl)pyridine-2,6-dione (PubChem CID 89151992) has the molecular formula C35H43F6NO5 and a molecular weight of 671.72 g/mol. Its IUPAC name is 3-ethyl-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-3-(4-propan-2-yloxyphenyl)pyridine-2,6-dione.
| Compound Name | 3-ethyl-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-3-(4-propan-2-yloxyphenyl)pyridine-2,6-dione |
|---|---|
| PubChem CID | 89151992 |
| Molecular Formula | C35H43F6NO5 |
| Molecular Weight | 671.72 g/mol |
| Exact Mass | 671.30 |
| IUPAC Name | 3-ethyl-1-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-3-(4-propan-2-yloxyphenyl)pyridine-2,6-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCN1C(=O)C=CC(CC)(c2ccc(OC(C)C)cc2)C1=O |
| InChI | InChI=1S/C35H43F6NO5/c1-6-11-24-21-27(33(45,34(36,37)38)35(39,40)41)22-25(12-7-2)30(24)46-20-10-9-19-42-29(43)17-18-32(8-3,31(42)44)26-13-15-28(16-14-26)47-23(4)5/h13-18,21-23,45H,6-12,19-20H2,1-5H3 |
| InChIKey | DMHJKRJFIWIOGQ-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.72 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|