C37H46F6N2O6 — CID 59235120
3-[4-[2-(2-cyclohexylethyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-propylphenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione (PubChem CID 59235120) has the molecular formula C37H46F6N2O6 and a molecular weight of 728.77 g/mol. Its IUPAC name is 3-[4-[2-(2-cyclohexylethyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-propylphenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione.
| Compound Name | 3-[4-[2-(2-cyclohexylethyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-propylphenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235120 |
| Molecular Formula | C37H46F6N2O6 |
| Molecular Weight | 728.77 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | 3-[4-[2-(2-cyclohexylethyl)-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-6-propylphenoxy]butyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-ethylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC2CCCCC2)c1OCCCCN1C(=O)NC(CC)(c2ccc3c(c2)OCCO3)C1=O |
| InChI | InChI=1S/C37H46F6N2O6/c1-3-10-25-21-28(35(48,36(38,39)40)37(41,42)43)22-26(14-13-24-11-6-5-7-12-24)31(25)51-18-9-8-17-45-32(46)34(4-2,44-33(45)47)27-15-16-29-30(23-27)50-20-19-49-29/h15-16,21-24,48H,3-14,17-20H2,1-2H3,(H,44,47) |
| InChIKey | SHMKQSOPFPVFBI-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.77 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|