C30H27F6N3O6 — CID 59201099
5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]imidazolidine-2,4-dione (PubChem CID 59201099) has the molecular formula C30H27F6N3O6 and a molecular weight of 639.55 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59201099 |
| Molecular Formula | C30H27F6N3O6 |
| Molecular Weight | 639.55 g/mol |
| Exact Mass | 639.18 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[[6-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-2-pyridinyl]methyl]imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(CN2C(=O)NC(CC)(c3ccc4c(c3)OCO4)C2=O)n1 |
| InChI | InChI=1S/C30H27F6N3O6/c1-3-6-17-13-19(28(42,29(31,32)33)30(34,35)36)10-11-21(17)45-24-8-5-7-20(37-24)15-39-25(40)27(4-2,38-26(39)41)18-9-12-22-23(14-18)44-16-43-22/h5,7-14,42H,3-4,6,15-16H2,1-2H3,(H,38,41) |
| InChIKey | KADPSZYJKDPFFJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 110.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.55 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|