C29H32F6N2O6 — CID 88586680
5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]ethyl]imidazolidine-2,4-dione (PubChem CID 88586680) has the molecular formula C29H32F6N2O6 and a molecular weight of 618.57 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]ethyl]imidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 88586680 |
| Molecular Formula | C29H32F6N2O6 |
| Molecular Weight | 618.57 g/mol |
| Exact Mass | 618.22 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-5-ethyl-3-[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]ethyl]imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCN1C(=O)NC(CC)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C29H32F6N2O6/c1-4-7-17-13-20(27(40,28(30,31)32)29(33,34)35)14-18(8-5-2)23(17)41-12-11-37-24(38)26(6-3,36-25(37)39)19-9-10-21-22(15-19)43-16-42-21/h9-10,13-15,40H,4-8,11-12,16H2,1-3H3,(H,36,39) |
| InChIKey | XBNGLJAZUKQQLD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.57 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|