C25H24F6N2O6 — CID 59234913
5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59234913) has the molecular formula C25H24F6N2O6 and a molecular weight of 562.46 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59234913 |
| Molecular Formula | C25H24F6N2O6 |
| Molecular Weight | 562.46 g/mol |
| Exact Mass | 562.15 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C25H24F6N2O6/c1-14-11-16(23(36,24(26,27)28)25(29,30)31)6-7-17(14)37-10-4-3-9-33-20(34)22(2,32-21(33)35)15-5-8-18-19(12-15)39-13-38-18/h5-8,11-12,36H,3-4,9-10,13H2,1-2H3,(H,32,35) |
| InChIKey | KDBIZROADSYOAK-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.46 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|