C27H30F6N2O5 — CID 59235048
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 59235048) has the molecular formula C27H30F6N2O5 and a molecular weight of 576.53 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235048 |
| Molecular Formula | C27H30F6N2O5 |
| Molecular Weight | 576.53 g/mol |
| Exact Mass | 576.21 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methylphenoxy]butyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc(OC(C)C)cc2)C1=O |
| InChI | InChI=1S/C27H30F6N2O5/c1-16(2)40-20-10-7-18(8-11-20)24(4)22(36)35(23(37)34-24)13-5-6-14-39-21-12-9-19(15-17(21)3)25(38,26(28,29)30)27(31,32)33/h7-12,15-16,38H,5-6,13-14H2,1-4H3,(H,34,37) |
| InChIKey | NXYKFFVTIRQZDW-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.53 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|