C29H30F6N2O5 — CID 59234896
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]but-2-ynyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 59234896) has the molecular formula C29H30F6N2O5 and a molecular weight of 600.56 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]but-2-ynyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]but-2-ynyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59234896 |
| Molecular Formula | C29H30F6N2O5 |
| Molecular Weight | 600.56 g/mol |
| Exact Mass | 600.21 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]but-2-ynyl]-5-methyl-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCC#CCN1C(=O)NC(C)(c2ccc(OC(C)C)cc2)C1=O |
| InChI | InChI=1S/C29H30F6N2O5/c1-5-8-19-17-21(27(40,28(30,31)32)29(33,34)35)11-14-23(19)41-16-7-6-15-37-24(38)26(4,36-25(37)39)20-9-12-22(13-10-20)42-18(2)3/h9-14,17-18,40H,5,8,15-16H2,1-4H3,(H,36,39) |
| InChIKey | OGTDRECDYKVDAB-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.56 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|