C26H27F7N2O4 — CID 24991435
5-(4-fluorophenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 24991435) has the molecular formula C26H27F7N2O4 and a molecular weight of 564.50 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-fluorophenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 24991435 |
| Molecular Formula | C26H27F7N2O4 |
| Molecular Weight | 564.50 g/mol |
| Exact Mass | 564.19 |
| IUPAC Name | 5-(4-fluorophenyl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C26H27F7N2O4/c1-3-6-16-15-18(24(38,25(28,29)30)26(31,32)33)9-12-20(16)39-14-5-4-13-35-21(36)23(2,34-22(35)37)17-7-10-19(27)11-8-17/h7-12,15,38H,3-6,13-14H2,1-2H3,(H,34,37) |
| InChIKey | LFSIRQWDICIBNU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.50 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|