C34H36F6N2O4 — CID 89152002
3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-[3-(2-phenylethyl)phenyl]imidazolidine-2,4-dione (PubChem CID 89152002) has the molecular formula C34H36F6N2O4 and a molecular weight of 650.66 g/mol. Its IUPAC name is 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-[3-(2-phenylethyl)phenyl]imidazolidine-2,4-dione.
| Compound Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-[3-(2-phenylethyl)phenyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 89152002 |
| Molecular Formula | C34H36F6N2O4 |
| Molecular Weight | 650.66 g/mol |
| Exact Mass | 650.26 |
| IUPAC Name | 3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methyl-5-[3-(2-phenylethyl)phenyl]imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2cccc(CCc3ccccc3)c2)C1=O |
| InChI | InChI=1S/C34H36F6N2O4/c1-3-10-25-22-27(32(45,33(35,36)37)34(38,39)40)17-18-28(25)46-20-8-7-19-42-29(43)31(2,41-30(42)44)26-14-9-13-24(21-26)16-15-23-11-5-4-6-12-23/h4-6,9,11-14,17-18,21-22,45H,3,7-8,10,15-16,19-20H2,1-2H3,(H,41,44) |
| InChIKey | ZZSFKUQILXLEQO-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.66 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|