C28H32F6N2O3 — CID 143683964
3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenyl]pentyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 143683964) has the molecular formula C28H32F6N2O3 and a molecular weight of 558.56 g/mol. Its IUPAC name is 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenyl]pentyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenyl]pentyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143683964 |
| Molecular Formula | C28H32F6N2O3 |
| Molecular Weight | 558.56 g/mol |
| Exact Mass | 558.23 |
| IUPAC Name | 3-[5-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-methyl-6-propylphenyl]pentyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(C)c1CCCCCN1C(=O)NC(C)(c2ccccc2)C1=O |
| InChI | InChI=1S/C28H32F6N2O3/c1-4-11-19-17-21(26(39,27(29,30)31)28(32,33)34)16-18(2)22(19)14-9-6-10-15-36-23(37)25(3,35-24(36)38)20-12-7-5-8-13-20/h5,7-8,12-13,16-17,39H,4,6,9-11,14-15H2,1-3H3,(H,35,38) |
| InChIKey | ISCCDDFWIILMER-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|