C32H38F6N2O4 — CID 59235071
5-(2,3-dihydro-1H-inden-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59235071) has the molecular formula C32H38F6N2O4 and a molecular weight of 628.65 g/mol. Its IUPAC name is 5-(2,3-dihydro-1H-inden-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235071 |
| Molecular Formula | C32H38F6N2O4 |
| Molecular Weight | 628.65 g/mol |
| Exact Mass | 628.27 |
| IUPAC Name | 5-(2,3-dihydro-1H-inden-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCN1C(=O)NC(C)(c2ccc3c(c2)CCC3)C1=O |
| InChI | InChI=1S/C32H38F6N2O4/c1-4-9-22-18-25(30(43,31(33,34)35)32(36,37)38)19-23(10-5-2)26(22)44-16-7-6-15-40-27(41)29(3,39-28(40)42)24-14-13-20-11-8-12-21(20)17-24/h13-14,17-19,43H,4-12,15-16H2,1-3H3,(H,39,42) |
| InChIKey | VPYZETRVNYIBKD-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.65 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|