C28H30F6N2O5 — CID 59235057
5-(2,3-dihydro-1-benzofuran-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59235057) has the molecular formula C28H30F6N2O5 and a molecular weight of 588.55 g/mol. Its IUPAC name is 5-(2,3-dihydro-1-benzofuran-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235057 |
| Molecular Formula | C28H30F6N2O5 |
| Molecular Weight | 588.55 g/mol |
| Exact Mass | 588.21 |
| IUPAC Name | 5-(2,3-dihydro-1-benzofuran-5-yl)-3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]butyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1OCCCCN1C(=O)NC(C)(c2ccc3c(c2)CCO3)C1=O |
| InChI | InChI=1S/C28H30F6N2O5/c1-3-6-17-16-20(26(39,27(29,30)31)28(32,33)34)8-10-21(17)40-13-5-4-12-36-23(37)25(2,35-24(36)38)19-7-9-22-18(15-19)11-14-41-22/h7-10,15-16,39H,3-6,11-14H2,1-2H3,(H,35,38) |
| InChIKey | DJIZNRJOTOKVMY-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.55 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|