C32H30F6N2O6 — CID 59201114
5-(1,3-benzodioxol-5-yl)-3-[3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]phenoxy]propyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59201114) has the molecular formula C32H30F6N2O6 and a molecular weight of 652.59 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]phenoxy]propyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]phenoxy]propyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59201114 |
| Molecular Formula | C32H30F6N2O6 |
| Molecular Weight | 652.59 g/mol |
| Exact Mass | 652.20 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[3-[4-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenyl]phenoxy]propyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1-c1ccc(OCCCN2C(=O)NC(C)(c3ccc4c(c3)OCO4)C2=O)cc1 |
| InChI | InChI=1S/C32H30F6N2O6/c1-3-5-20-16-22(30(43,31(33,34)35)32(36,37)38)8-12-24(20)19-6-10-23(11-7-19)44-15-4-14-40-27(41)29(2,39-28(40)42)21-9-13-25-26(17-21)46-18-45-25/h6-13,16-17,43H,3-5,14-15,18H2,1-2H3,(H,39,42) |
| InChIKey | OWUUDBJLRAELTJ-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|