C36H46F6N2O6 — CID 59235002
5-(1,3-benzodioxol-5-yl)-3-[10-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]decyl]-5-methylimidazolidine-2,4-dione (PubChem CID 59235002) has the molecular formula C36H46F6N2O6 and a molecular weight of 716.76 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-yl)-3-[10-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]decyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(1,3-benzodioxol-5-yl)-3-[10-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]decyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59235002 |
| Molecular Formula | C36H46F6N2O6 |
| Molecular Weight | 716.76 g/mol |
| Exact Mass | 716.33 |
| IUPAC Name | 5-(1,3-benzodioxol-5-yl)-3-[10-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,6-dipropylphenoxy]decyl]-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)cc(CCC)c1OCCCCCCCCCCN1C(=O)NC(C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C36H46F6N2O6/c1-4-14-24-20-27(34(47,35(37,38)39)36(40,41)42)21-25(15-5-2)30(24)48-19-13-11-9-7-6-8-10-12-18-44-31(45)33(3,43-32(44)46)26-16-17-28-29(22-26)50-23-49-28/h16-17,20-22,47H,4-15,18-19,23H2,1-3H3,(H,43,46) |
| InChIKey | CUTUBTKMFHSCAL-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.76 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|