C30H28F6N2O4 — CID 59200936
3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 59200936) has the molecular formula C30H28F6N2O4 and a molecular weight of 594.55 g/mol. Its IUPAC name is 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200936 |
| Molecular Formula | C30H28F6N2O4 |
| Molecular Weight | 594.55 g/mol |
| Exact Mass | 594.20 |
| IUPAC Name | 3-[[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]methyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(CN2C(=O)NC(C)(c3ccc(C)cc3)C2=O)c1 |
| InChI | InChI=1S/C30H28F6N2O4/c1-4-6-20-16-22(28(41,29(31,32)33)30(34,35)36)13-14-24(20)42-23-8-5-7-19(15-23)17-38-25(39)27(3,37-26(38)40)21-11-9-18(2)10-12-21/h5,7-16,41H,4,6,17H2,1-3H3,(H,37,40) |
| InChIKey | SWJDYLSMXZONBS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.55 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|