C29H28F6N4O5 — CID 143901077
3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-5-methyl-4-pyridinyl]methyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione (PubChem CID 143901077) has the molecular formula C29H28F6N4O5 and a molecular weight of 626.55 g/mol. Its IUPAC name is 3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-5-methyl-4-pyridinyl]methyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-5-methyl-4-pyridinyl]methyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143901077 |
| Molecular Formula | C29H28F6N4O5 |
| Molecular Weight | 626.55 g/mol |
| Exact Mass | 626.20 |
| IUPAC Name | 3-[[2-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]-5-methyl-4-pyridinyl]methyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cc(CN2C(=O)NC(C)(c3ccc(OC)nc3)C2=O)c(C)cn1 |
| InChI | InChI=1S/C29H28F6N4O5/c1-5-6-17-11-19(27(42,28(30,31)32)29(33,34)35)7-9-21(17)44-23-12-18(16(2)13-36-23)15-39-24(40)26(3,38-25(39)41)20-8-10-22(43-4)37-14-20/h7-14,42H,5-6,15H2,1-4H3,(H,38,41) |
| InChIKey | PUXPOPAFHDXMMQ-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 113.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.55 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|