C30H29F6N3O5 — CID 59200989
3-[1-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]ethyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione (PubChem CID 59200989) has the molecular formula C30H29F6N3O5 and a molecular weight of 625.57 g/mol. Its IUPAC name is 3-[1-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]ethyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[1-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]ethyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 59200989 |
| Molecular Formula | C30H29F6N3O5 |
| Molecular Weight | 625.57 g/mol |
| Exact Mass | 625.20 |
| IUPAC Name | 3-[1-[3-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-propylphenoxy]phenyl]ethyl]-5-(6-methoxy-3-pyridinyl)-5-methylimidazolidine-2,4-dione |
| SMILES | CCCc1cc(C(O)(C(F)(F)F)C(F)(F)F)ccc1Oc1cccc(C(C)N2C(=O)NC(C)(c3ccc(OC)nc3)C2=O)c1 |
| InChI | InChI=1S/C30H29F6N3O5/c1-5-7-19-14-20(28(42,29(31,32)33)30(34,35)36)10-12-23(19)44-22-9-6-8-18(15-22)17(2)39-25(40)27(3,38-26(39)41)21-11-13-24(43-4)37-16-21/h6,8-17,42H,5,7H2,1-4H3,(H,38,41) |
| InChIKey | LPVWYWGIYNUHMP-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 100.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.57 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|