C30H33F3N2O6 — CID 87263742
5-methyl-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione (PubChem CID 87263742) has the molecular formula C30H33F3N2O6 and a molecular weight of 574.60 g/mol. Its IUPAC name is 5-methyl-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 5-methyl-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 87263742 |
| Molecular Formula | C30H33F3N2O6 |
| Molecular Weight | 574.60 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 5-methyl-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]-5-(4-propan-2-yloxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1c(OCCCCN2C(=O)NC(C)(c3ccc(OC(C)C)cc3)C2=O)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C30H33F3N2O6/c1-5-8-22-24(14-13-21-23(30(31,32)33)17-25(36)41-26(21)22)39-16-7-6-15-35-27(37)29(4,34-28(35)38)19-9-11-20(12-10-19)40-18(2)3/h9-14,17-18H,5-8,15-16H2,1-4H3,(H,34,38) |
| InChIKey | DAIODDIHZJCKCQ-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 98.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|