C19H24F3NO3 — CID 89009766
7-(6-aminohexoxy)-8-propyl-4-(trifluoromethyl)chromen-2-one (PubChem CID 89009766) has the molecular formula C19H24F3NO3 and a molecular weight of 371.40 g/mol. Its IUPAC name is 7-(6-aminohexoxy)-8-propyl-4-(trifluoromethyl)chromen-2-one.
| Compound Name | 7-(6-aminohexoxy)-8-propyl-4-(trifluoromethyl)chromen-2-one |
|---|---|
| PubChem CID | 89009766 |
| Molecular Formula | C19H24F3NO3 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 7-(6-aminohexoxy)-8-propyl-4-(trifluoromethyl)chromen-2-one |
| SMILES | CCCc1c(OCCCCCCN)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C19H24F3NO3/c1-2-7-14-16(25-11-6-4-3-5-10-23)9-8-13-15(19(20,21)22)12-17(24)26-18(13)14/h8-9,12H,2-7,10-11,23H2,1H3 |
| InChIKey | ZLSZTXYMHFYJEA-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|