C27H25F5N2O5 — CID 90932247
1-(2,5-difluorophenyl)-4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazol-2-one (PubChem CID 90932247) has the molecular formula C27H25F5N2O5 and a molecular weight of 552.50 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazol-2-one.
| Compound Name | 1-(2,5-difluorophenyl)-4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazol-2-one |
|---|---|
| PubChem CID | 90932247 |
| Molecular Formula | C27H25F5N2O5 |
| Molecular Weight | 552.50 g/mol |
| Exact Mass | 552.17 |
| IUPAC Name | 1-(2,5-difluorophenyl)-4-hydroxy-3-[5-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypentyl]imidazol-2-one |
| SMILES | CCCc1c(OCCCCCn2c(O)cn(-c3cc(F)ccc3F)c2=O)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C27H25F5N2O5/c1-2-6-18-22(10-8-17-19(27(30,31)32)14-24(36)39-25(17)18)38-12-5-3-4-11-33-23(35)15-34(26(33)37)21-13-16(28)7-9-20(21)29/h7-10,13-15,35H,2-6,11-12H2,1H3 |
| InChIKey | CJHNTGHLFBFKKP-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.50 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|