C32H35F3N2O7 — CID 89147675
tert-butyl 4-[4-methyl-2,5-dioxo-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]imidazolidin-4-yl]benzoate (PubChem CID 89147675) has the molecular formula C32H35F3N2O7 and a molecular weight of 616.63 g/mol. Its IUPAC name is tert-butyl 4-[4-methyl-2,5-dioxo-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]imidazolidin-4-yl]benzoate.
| Compound Name | tert-butyl 4-[4-methyl-2,5-dioxo-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]imidazolidin-4-yl]benzoate |
|---|---|
| PubChem CID | 89147675 |
| Molecular Formula | C32H35F3N2O7 |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | tert-butyl 4-[4-methyl-2,5-dioxo-3-[4-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxybutyl]imidazolidin-4-yl]benzoate |
| SMILES | CCCc1c(OCCCCN2C(=O)NC(=O)C2(C)c2ccc(C(=O)OC(C)(C)C)cc2)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C32H35F3N2O7/c1-6-9-22-24(15-14-21-23(32(33,34)35)18-25(38)43-26(21)22)42-17-8-7-16-37-29(41)36-28(40)31(37,5)20-12-10-19(11-13-20)27(39)44-30(2,3)4/h10-15,18H,6-9,16-17H2,1-5H3,(H,36,40,41) |
| InChIKey | RSTPCBRKOJQKPH-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|