C22H25F3N2O5 — CID 91293803
4-hydroxy-3-[3-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-1-propan-2-ylimidazol-2-one (PubChem CID 91293803) has the molecular formula C22H25F3N2O5 and a molecular weight of 454.45 g/mol. Its IUPAC name is 4-hydroxy-3-[3-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-1-propan-2-ylimidazol-2-one.
| Compound Name | 4-hydroxy-3-[3-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-1-propan-2-ylimidazol-2-one |
|---|---|
| PubChem CID | 91293803 |
| Molecular Formula | C22H25F3N2O5 |
| Molecular Weight | 454.45 g/mol |
| Exact Mass | 454.17 |
| IUPAC Name | 4-hydroxy-3-[3-[2-oxo-8-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-1-propan-2-ylimidazol-2-one |
| SMILES | CCCc1c(OCCCn2c(O)cn(C(C)C)c2=O)ccc2c(C(F)(F)F)cc(=O)oc12 |
| InChI | InChI=1S/C22H25F3N2O5/c1-4-6-15-17(8-7-14-16(22(23,24)25)11-19(29)32-20(14)15)31-10-5-9-26-18(28)12-27(13(2)3)21(26)30/h7-8,11-13,28H,4-6,9-10H2,1-3H3 |
| InChIKey | YGHSVDWNELGUIJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 86.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|