C21H22F3NO5S — CID 90823087
3-[3-[8-ethyl-2-oxo-6-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-4-hydroxy-1,3-thiazol-2-one (PubChem CID 90823087) has the molecular formula C21H22F3NO5S and a molecular weight of 457.47 g/mol. Its IUPAC name is 3-[3-[8-ethyl-2-oxo-6-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-4-hydroxy-1,3-thiazol-2-one.
| Compound Name | 3-[3-[8-ethyl-2-oxo-6-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-4-hydroxy-1,3-thiazol-2-one |
|---|---|
| PubChem CID | 90823087 |
| Molecular Formula | C21H22F3NO5S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | 3-[3-[8-ethyl-2-oxo-6-propyl-4-(trifluoromethyl)chromen-7-yl]oxypropyl]-4-hydroxy-1,3-thiazol-2-one |
| SMILES | CCCc1cc2c(C(F)(F)F)cc(=O)oc2c(CC)c1OCCCn1c(O)csc1=O |
| InChI | InChI=1S/C21H22F3NO5S/c1-3-6-12-9-14-15(21(22,23)24)10-17(27)30-19(14)13(4-2)18(12)29-8-5-7-25-16(26)11-31-20(25)28/h9-11,26H,3-8H2,1-2H3 |
| InChIKey | KETSRLDSWXEZBN-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|